C24H22N4O4S2 — CID 166634639
(1R,2R,3S,11S,14R)-2-hydroxy-14-[(1R)-1-hydroxyethyl]-3-(1H-indol-3-yl)-18-methyl-15,16-dithia-10,12,18-triazapentacyclo[12.2.2.01,12.03,11.04,9]octadeca-4,6,8-triene-13,17-dione (PubChem CID 166634639) has the molecular formula C24H22N4O4S2 and a molecular weight of 494.60 g/mol. Its IUPAC name is (1R,2R,3S,11S,14R)-2-hydroxy-14-[(1R)-1-hydroxyethyl]-3-(1H-indol-3-yl)-18-methyl-15,16-dithia-10,12,18-triazapentacyclo[12.2.2.01,12.03,11.04,9]octadeca-4,6,8-triene-13,17-dione.
| Compound Name | (1R,2R,3S,11S,14R)-2-hydroxy-14-[(1R)-1-hydroxyethyl]-3-(1H-indol-3-yl)-18-methyl-15,16-dithia-10,12,18-triazapentacyclo[12.2.2.01,12.03,11.04,9]octadeca-4,6,8-triene-13,17-dione |
|---|---|
| PubChem CID | 166634639 |
| Molecular Formula | C24H22N4O4S2 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | (1R,2R,3S,11S,14R)-2-hydroxy-14-[(1R)-1-hydroxyethyl]-3-(1H-indol-3-yl)-18-methyl-15,16-dithia-10,12,18-triazapentacyclo[12.2.2.01,12.03,11.04,9]octadeca-4,6,8-triene-13,17-dione |
| SMILES | C[C@@H](O)[C@]12SS[C@@]3(C(=O)N1C)[C@H](O)[C@@]1(c4c[nH]c5ccccc45)c4ccccc4N[C@H]1N3C2=O |
| InChI | InChI=1S/C24H22N4O4S2/c1-12(29)23-21(32)28-19-22(14-8-4-6-10-17(14)26-19,15-11-25-16-9-5-3-7-13(15)16)18(30)24(28,34-33-23)20(31)27(23)2/h3-12,18-19,25-26,29-30H,1-2H3/t12-,18-,19+,22+,23-,24-/m1/s1 |
| InChIKey | RXMWCUHVQJFPOO-RKRLWLPGSA-N |
| XLogP | 2.05 |
| TPSA | 108.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|