C33H28FN5O3 — CID 166634706
N-(2-aminophenyl)-2-[(17-fluoro-21-methyl-14-oxo-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7,15(20),16,18-heptaen-7-yl)oxymethyl]benzamide (PubChem CID 166634706) has the molecular formula C33H28FN5O3 and a molecular weight of 561.62 g/mol. Its IUPAC name is N-(2-aminophenyl)-2-[(17-fluoro-21-methyl-14-oxo-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7,15(20),16,18-heptaen-7-yl)oxymethyl]benzamide.
| Compound Name | N-(2-aminophenyl)-2-[(17-fluoro-21-methyl-14-oxo-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7,15(20),16,18-heptaen-7-yl)oxymethyl]benzamide |
|---|---|
| PubChem CID | 166634706 |
| Molecular Formula | C33H28FN5O3 |
| Molecular Weight | 561.62 g/mol |
| Exact Mass | 561.22 |
| IUPAC Name | N-(2-aminophenyl)-2-[(17-fluoro-21-methyl-14-oxo-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7,15(20),16,18-heptaen-7-yl)oxymethyl]benzamide |
| SMILES | CN1c2ccc(F)cc2C(=O)N2CCc3c([nH]c4ccc(OCc5ccccc5C(=O)Nc5ccccc5N)cc34)C21 |
| InChI | InChI=1S/C33H28FN5O3/c1-38-29-13-10-20(34)16-25(29)33(41)39-15-14-23-24-17-21(11-12-27(24)36-30(23)32(38)39)42-18-19-6-2-3-7-22(19)31(40)37-28-9-5-4-8-26(28)35/h2-13,16-17,32,36H,14-15,18,35H2,1H3,(H,37,40) |
| InChIKey | DLWCNKJQJTVKPP-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 103.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.62 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|