C28H30N6O4S — CID 166634707
(E)-3-[3,5-dimethyl-4-[[2-[4-(4-methylsulfonylpiperazin-1-yl)anilino]-5,7-dihydrofuro[3,4-d]pyrimidin-4-yl]oxy]phenyl]prop-2-enenitrile (PubChem CID 166634707) has the molecular formula C28H30N6O4S and a molecular weight of 546.65 g/mol. Its IUPAC name is (E)-3-[3,5-dimethyl-4-[[2-[4-(4-methylsulfonylpiperazin-1-yl)anilino]-5,7-dihydrofuro[3,4-d]pyrimidin-4-yl]oxy]phenyl]prop-2-enenitrile.
| Compound Name | (E)-3-[3,5-dimethyl-4-[[2-[4-(4-methylsulfonylpiperazin-1-yl)anilino]-5,7-dihydrofuro[3,4-d]pyrimidin-4-yl]oxy]phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 166634707 |
| Molecular Formula | C28H30N6O4S |
| Molecular Weight | 546.65 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | (E)-3-[3,5-dimethyl-4-[[2-[4-(4-methylsulfonylpiperazin-1-yl)anilino]-5,7-dihydrofuro[3,4-d]pyrimidin-4-yl]oxy]phenyl]prop-2-enenitrile |
| SMILES | Cc1cc(/C=C/C#N)cc(C)c1Oc1nc(Nc2ccc(N3CCN(S(C)(=O)=O)CC3)cc2)nc2c1COC2 |
| InChI | InChI=1S/C28H30N6O4S/c1-19-15-21(5-4-10-29)16-20(2)26(19)38-27-24-17-37-18-25(24)31-28(32-27)30-22-6-8-23(9-7-22)33-11-13-34(14-12-33)39(3,35)36/h4-9,15-16H,11-14,17-18H2,1-3H3,(H,30,31,32)/b5-4+ |
| InChIKey | LTDZOUYQYINDNQ-SNAWJCMRSA-N |
| XLogP | 4.28 |
| TPSA | 120.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.65 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|