C31H35N7OS — CID 166634708
3-[[2-[[2-[(1-benzylpiperidin-4-yl)amino]-1,3-benzothiazol-6-yl]amino]-6-methylquinazolin-4-yl]amino]propan-1-ol (PubChem CID 166634708) has the molecular formula C31H35N7OS and a molecular weight of 553.74 g/mol. Its IUPAC name is 3-[[2-[[2-[(1-benzylpiperidin-4-yl)amino]-1,3-benzothiazol-6-yl]amino]-6-methylquinazolin-4-yl]amino]propan-1-ol.
| Compound Name | 3-[[2-[[2-[(1-benzylpiperidin-4-yl)amino]-1,3-benzothiazol-6-yl]amino]-6-methylquinazolin-4-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 166634708 |
| Molecular Formula | C31H35N7OS |
| Molecular Weight | 553.74 g/mol |
| Exact Mass | 553.26 |
| IUPAC Name | 3-[[2-[[2-[(1-benzylpiperidin-4-yl)amino]-1,3-benzothiazol-6-yl]amino]-6-methylquinazolin-4-yl]amino]propan-1-ol |
| SMILES | Cc1ccc2nc(Nc3ccc4nc(NC5CCN(Cc6ccccc6)CC5)sc4c3)nc(NCCCO)c2c1 |
| InChI | InChI=1S/C31H35N7OS/c1-21-8-10-26-25(18-21)29(32-14-5-17-39)37-30(35-26)33-24-9-11-27-28(19-24)40-31(36-27)34-23-12-15-38(16-13-23)20-22-6-3-2-4-7-22/h2-4,6-11,18-19,23,39H,5,12-17,20H2,1H3,(H,34,36)(H2,32,33,35,37) |
| InChIKey | JUVANFFYVRYUKW-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.74 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|