C17H26O7 — CID 166634762
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[2-(4-methoxyphenyl)-2-methylpropoxy]oxane-3,4,5-triol (PubChem CID 166634762) has the molecular formula C17H26O7 and a molecular weight of 342.39 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[2-(4-methoxyphenyl)-2-methylpropoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[2-(4-methoxyphenyl)-2-methylpropoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 166634762 |
| Molecular Formula | C17H26O7 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[2-(4-methoxyphenyl)-2-methylpropoxy]oxane-3,4,5-triol |
| SMILES | COc1ccc(C(C)(C)CO[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C17H26O7/c1-17(2,10-4-6-11(22-3)7-5-10)9-23-16-15(21)14(20)13(19)12(8-18)24-16/h4-7,12-16,18-21H,8-9H2,1-3H3/t12-,13-,14+,15-,16-/m1/s1 |
| InChIKey | OXLSVJSKSUDUGW-IBEHDNSVSA-N |
| XLogP | -0.21 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |