C26H32O6 — CID 166634814
[(2R,4R,8R,9S,13R)-5,5,9-trimethyl-14-methylidene-10,15-dioxo-2-prop-2-enoyloxy-8-tricyclo[11.2.1.04,9]hexadec-1(16)-enyl] prop-2-enoate (PubChem CID 166634814) has the molecular formula C26H32O6 and a molecular weight of 440.54 g/mol. Its IUPAC name is [(2R,4R,8R,9S,13R)-5,5,9-trimethyl-14-methylidene-10,15-dioxo-2-prop-2-enoyloxy-8-tricyclo[11.2.1.04,9]hexadec-1(16)-enyl] prop-2-enoate.
| Compound Name | [(2R,4R,8R,9S,13R)-5,5,9-trimethyl-14-methylidene-10,15-dioxo-2-prop-2-enoyloxy-8-tricyclo[11.2.1.04,9]hexadec-1(16)-enyl] prop-2-enoate |
|---|---|
| PubChem CID | 166634814 |
| Molecular Formula | C26H32O6 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | [(2R,4R,8R,9S,13R)-5,5,9-trimethyl-14-methylidene-10,15-dioxo-2-prop-2-enoyloxy-8-tricyclo[11.2.1.04,9]hexadec-1(16)-enyl] prop-2-enoate |
| SMILES | C=CC(=O)O[C@@H]1C[C@@H]2C(C)(C)CC[C@@H](OC(=O)C=C)[C@@]2(C)C(=O)CC[C@@H]2C=C1C(=O)C2=C |
| InChI | InChI=1S/C26H32O6/c1-7-22(28)31-18-14-19-25(4,5)12-11-21(32-23(29)8-2)26(19,6)20(27)10-9-16-13-17(18)24(30)15(16)3/h7-8,13,16,18-19,21H,1-3,9-12,14H2,4-6H3/t16-,18-,19-,21-,26-/m1/s1 |
| InChIKey | NIKVKYFZVCZWCS-OOJSWDJXSA-N |
| XLogP | 4.06 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|