C25H28N2O5 — CID 166634884
5-[2-(dimethylamino)ethyl]-2,3,8,9-tetramethoxybenzo[c]phenanthridin-6-one (PubChem CID 166634884) has the molecular formula C25H28N2O5 and a molecular weight of 436.51 g/mol. Its IUPAC name is 5-[2-(dimethylamino)ethyl]-2,3,8,9-tetramethoxybenzo[c]phenanthridin-6-one.
| Compound Name | 5-[2-(dimethylamino)ethyl]-2,3,8,9-tetramethoxybenzo[c]phenanthridin-6-one |
|---|---|
| PubChem CID | 166634884 |
| Molecular Formula | C25H28N2O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 5-[2-(dimethylamino)ethyl]-2,3,8,9-tetramethoxybenzo[c]phenanthridin-6-one |
| SMILES | COc1cc2ccc3c4cc(OC)c(OC)cc4c(=O)n(CCN(C)C)c3c2cc1OC |
| InChI | InChI=1S/C25H28N2O5/c1-26(2)9-10-27-24-16(8-7-15-11-20(29-3)21(30-4)12-17(15)24)18-13-22(31-5)23(32-6)14-19(18)25(27)28/h7-8,11-14H,9-10H2,1-6H3 |
| InChIKey | ZYAKTTFWPUIVGH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 62.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|