C20H28O2 — CID 166634912
(1R,3E,10R,17S)-3,10,14-trimethyl-7-methylidene-16-oxatricyclo[8.6.1.013,17]heptadeca-3,13-dien-15-one (PubChem CID 166634912) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is (1R,3E,10R,17S)-3,10,14-trimethyl-7-methylidene-16-oxatricyclo[8.6.1.013,17]heptadeca-3,13-dien-15-one.
| Compound Name | (1R,3E,10R,17S)-3,10,14-trimethyl-7-methylidene-16-oxatricyclo[8.6.1.013,17]heptadeca-3,13-dien-15-one |
|---|---|
| PubChem CID | 166634912 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (1R,3E,10R,17S)-3,10,14-trimethyl-7-methylidene-16-oxatricyclo[8.6.1.013,17]heptadeca-3,13-dien-15-one |
| SMILES | C=C1CC/C=C(\C)C[C@H]2OC(=O)C(C)=C3CC[C@@](C)(CC1)[C@@H]32 |
| InChI | InChI=1S/C20H28O2/c1-13-6-5-7-14(2)12-17-18-16(15(3)19(21)22-17)9-11-20(18,4)10-8-13/h7,17-18H,1,5-6,8-12H2,2-4H3/b14-7+/t17-,18+,20-/m1/s1 |
| InChIKey | VCFLGYKQUIAAOB-PCOJCTDQSA-N |
| XLogP | 5.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|