C25H31BF2I3N3 — CID 166634956
2,2-difluoro-8-(1-heptylpyridin-1-ium-3-yl)-5,11-diiodo-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene iodide (PubChem CID 166634956) has the molecular formula C25H31BF2I3N3 and a molecular weight of 803.06 g/mol. Its IUPAC name is 2,2-difluoro-8-(1-heptylpyridin-1-ium-3-yl)-5,11-diiodo-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene iodide.
| Compound Name | 2,2-difluoro-8-(1-heptylpyridin-1-ium-3-yl)-5,11-diiodo-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene iodide |
|---|---|
| PubChem CID | 166634956 |
| Molecular Formula | C25H31BF2I3N3 |
| Molecular Weight | 803.06 g/mol |
| Exact Mass | 802.97 |
| IUPAC Name | 2,2-difluoro-8-(1-heptylpyridin-1-ium-3-yl)-5,11-diiodo-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene iodide |
| SMILES | CCCCCCC[n+]1cccc(C2=C3C(C)=C(I)C(C)=[N+]3[B-](F)(F)n3c(C)c(I)c(C)c32)c1.[I-] |
| InChI | InChI=1S/C25H31BF2I2N3.HI/c1-6-7-8-9-10-13-31-14-11-12-20(15-31)21-24-16(2)22(29)18(4)32(24)26(27,28)33-19(5)23(30)17(3)25(21)33;/h11-12,14-15H,6-10,13H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | RKSUXVAEPMFMJE-UHFFFAOYSA-M |
| XLogP | 4.16 |
| TPSA | 11.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.06 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|