C18H28N2O2 — CID 166634968
1-[(E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperidine-4-carboxamide (PubChem CID 166634968) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is 1-[(E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperidine-4-carboxamide.
| Compound Name | 1-[(E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 166634968 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 1-[(E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperidine-4-carboxamide |
| SMILES | CC1=C(/C=C/C(=O)N2CCC(C(N)=O)CC2)C(C)(C)CCC1 |
| InChI | InChI=1S/C18H28N2O2/c1-13-5-4-10-18(2,3)15(13)6-7-16(21)20-11-8-14(9-12-20)17(19)22/h6-7,14H,4-5,8-12H2,1-3H3,(H2,19,22)/b7-6+ |
| InChIKey | REFYUGHNAOHCPC-VOTSOKGWSA-N |
| XLogP | 2.79 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|