About 1-[(E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperidine-4-carbonitrile
1-[(E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperidine-4-carbonitrile (PubChem CID 166634985) has the molecular formula C18H26N2O
and a molecular weight of 286.42 g/mol. Its IUPAC name is 1-[(E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperidine-4-carbonitrile.
Molecular Properties
| Compound Name | 1-[(E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperidine-4-carbonitrile |
| PubChem CID | 166634985 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 1-[(E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperidine-4-carbonitrile |
| SMILES | CC1=C(/C=C/C(=O)N2CCC(C#N)CC2)C(C)(C)CCC1 |
| InChI | InChI=1S/C18H26N2O/c1-14-5-4-10-18(2,3)16(14)6-7-17(21)20-11-8-15(13-19)9-12-20/h6-7,15H,4-5,8-12H2,1-3H3/b7-6+ |
| InChIKey | CLSIYHNJKZDCOO-VOTSOKGWSA-N |
| XLogP | 3.83 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperidine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperidine-4-carbonitrile?
The IUPAC name of 1-[(E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperidine-4-carbonitrile (CID 166634985) is 1-[(E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperidine-4-carbonitrile.
What is the SMILES notation for 1-[(E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperidine-4-carbonitrile?
The canonical SMILES for 1-[(E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperidine-4-carbonitrile is CC1=C(/C=C/C(=O)N2CCC(C#N)CC2)C(C)(C)CCC1.
What is the InChIKey of 1-[(E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperidine-4-carbonitrile?
The InChIKey is CLSIYHNJKZDCOO-VOTSOKGWSA-N. The full InChI is InChI=1S/C18H26N2O/c1-14-5-4-10-18(2,3)16(14)6-7-17(21)20-11-8-15(13-19)9-12-20/h6-7,15H,4-5,8-12H2,1-3H3/b7-6+.
What are the key properties of 1-[(E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperidine-4-carbonitrile?
1-[(E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperidine-4-carbonitrile has a molecular weight of 286.42 g/mol, XLogP of 3.83, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperidine-4-carbonitrile is sourced from PubChem (CID 166634985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).