C26H29F3N2O2 — CID 166635027
(E)-3-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3,9-dimethyl-3,4,4a,9a-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid (PubChem CID 166635027) has the molecular formula C26H29F3N2O2 and a molecular weight of 458.52 g/mol. Its IUPAC name is (E)-3-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3,9-dimethyl-3,4,4a,9a-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3,9-dimethyl-3,4,4a,9a-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 166635027 |
| Molecular Formula | C26H29F3N2O2 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | (E)-3-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3,9-dimethyl-3,4,4a,9a-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid |
| SMILES | C[C@@H]1CC2c3ccccc3N(C)C2[C@@H](c2c(F)cc(/C=C/C(=O)O)cc2F)N1CC(C)(C)F |
| InChI | InChI=1S/C26H29F3N2O2/c1-15-11-18-17-7-5-6-8-21(17)30(4)24(18)25(31(15)14-26(2,3)29)23-19(27)12-16(13-20(23)28)9-10-22(32)33/h5-10,12-13,15,18,24-25H,11,14H2,1-4H3,(H,32,33)/b10-9+/t15-,18?,24?,25-/m1/s1 |
| InChIKey | GSHNKOVUNZCMJG-PCQHVHAWSA-N |
| XLogP | 5.55 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|