C17H24ClF3N2O4S — CID 166635067
2-chloro-5-(dimethylsulfamoyl)-4-(8,8,8-trifluorooctylamino)benzoic acid (PubChem CID 166635067) has the molecular formula C17H24ClF3N2O4S and a molecular weight of 444.90 g/mol. Its IUPAC name is 2-chloro-5-(dimethylsulfamoyl)-4-(8,8,8-trifluorooctylamino)benzoic acid.
| Compound Name | 2-chloro-5-(dimethylsulfamoyl)-4-(8,8,8-trifluorooctylamino)benzoic acid |
|---|---|
| PubChem CID | 166635067 |
| Molecular Formula | C17H24ClF3N2O4S |
| Molecular Weight | 444.90 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 2-chloro-5-(dimethylsulfamoyl)-4-(8,8,8-trifluorooctylamino)benzoic acid |
| SMILES | CN(C)S(=O)(=O)c1cc(C(=O)O)c(Cl)cc1NCCCCCCCC(F)(F)F |
| InChI | InChI=1S/C17H24ClF3N2O4S/c1-23(2)28(26,27)15-10-12(16(24)25)13(18)11-14(15)22-9-7-5-3-4-6-8-17(19,20)21/h10-11,22H,3-9H2,1-2H3,(H,24,25) |
| InChIKey | LHFCJEKDZYFELB-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.90 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|