C23H29N7OS — CID 166635073
3-[[2-[[2-[2-(dimethylamino)ethylamino]-1,3-benzothiazol-6-yl]amino]-6-methylquinazolin-4-yl]amino]propan-1-ol (PubChem CID 166635073) has the molecular formula C23H29N7OS and a molecular weight of 451.60 g/mol. Its IUPAC name is 3-[[2-[[2-[2-(dimethylamino)ethylamino]-1,3-benzothiazol-6-yl]amino]-6-methylquinazolin-4-yl]amino]propan-1-ol.
| Compound Name | 3-[[2-[[2-[2-(dimethylamino)ethylamino]-1,3-benzothiazol-6-yl]amino]-6-methylquinazolin-4-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 166635073 |
| Molecular Formula | C23H29N7OS |
| Molecular Weight | 451.60 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | 3-[[2-[[2-[2-(dimethylamino)ethylamino]-1,3-benzothiazol-6-yl]amino]-6-methylquinazolin-4-yl]amino]propan-1-ol |
| SMILES | Cc1ccc2nc(Nc3ccc4nc(NCCN(C)C)sc4c3)nc(NCCCO)c2c1 |
| InChI | InChI=1S/C23H29N7OS/c1-15-5-7-18-17(13-15)21(24-9-4-12-31)29-22(27-18)26-16-6-8-19-20(14-16)32-23(28-19)25-10-11-30(2)3/h5-8,13-14,31H,4,9-12H2,1-3H3,(H,25,28)(H2,24,26,27,29) |
| InChIKey | JLLZWGMOCRCVMG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.60 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|