C31H35N5O5 — CID 166635133
2-[4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)-2,6-dimethylphenoxy]-N-[4-(4-methylpiperazin-1-yl)phenyl]acetamide (PubChem CID 166635133) has the molecular formula C31H35N5O5 and a molecular weight of 557.65 g/mol. Its IUPAC name is 2-[4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)-2,6-dimethylphenoxy]-N-[4-(4-methylpiperazin-1-yl)phenyl]acetamide.
| Compound Name | 2-[4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)-2,6-dimethylphenoxy]-N-[4-(4-methylpiperazin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 166635133 |
| Molecular Formula | C31H35N5O5 |
| Molecular Weight | 557.65 g/mol |
| Exact Mass | 557.26 |
| IUPAC Name | 2-[4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)-2,6-dimethylphenoxy]-N-[4-(4-methylpiperazin-1-yl)phenyl]acetamide |
| SMILES | COc1cc(OC)c2c(=O)[nH]c(-c3cc(C)c(OCC(=O)Nc4ccc(N5CCN(C)CC5)cc4)c(C)c3)nc2c1 |
| InChI | InChI=1S/C31H35N5O5/c1-19-14-21(30-33-25-16-24(39-4)17-26(40-5)28(25)31(38)34-30)15-20(2)29(19)41-18-27(37)32-22-6-8-23(9-7-22)36-12-10-35(3)11-13-36/h6-9,14-17H,10-13,18H2,1-5H3,(H,32,37)(H,33,34,38) |
| InChIKey | IOVRABNFDZBFAT-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 109.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.65 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|