C28H35N6O8P — CID 166635182
cyclohexylmethyl (2S)-2-[[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 166635182) has the molecular formula C28H35N6O8P and a molecular weight of 614.60 g/mol. Its IUPAC name is cyclohexylmethyl (2S)-2-[[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | cyclohexylmethyl (2S)-2-[[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 166635182 |
| Molecular Formula | C28H35N6O8P |
| Molecular Weight | 614.60 g/mol |
| Exact Mass | 614.23 |
| IUPAC Name | cyclohexylmethyl (2S)-2-[[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](N[P@](=O)(OC[C@H]1O[C@@](C#N)(c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O)Oc1ccccc1)C(=O)OCC1CCCCC1 |
| InChI | InChI=1S/C28H35N6O8P/c1-18(27(37)39-14-19-8-4-2-5-9-19)33-43(38,42-20-10-6-3-7-11-20)40-15-22-24(35)25(36)28(16-29,41-22)23-13-12-21-26(30)31-17-32-34(21)23/h3,6-7,10-13,17-19,22,24-25,35-36H,2,4-5,8-9,14-15H2,1H3,(H,33,38)(H2,30,31,32)/t18-,22+,24+,25+,28-,43-/m0/s1 |
| InChIKey | GYZOPIITTYHBMH-KUJHTASFSA-N |
| XLogP | 2.46 |
| TPSA | 203.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.60 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|