C20H20FN5O4 — CID 166635223
5-(3-fluoro-4-methoxyphenyl)-1,4-dimethyl-8-nitro-3,4a-dihydro-2H-pyrazino[2,3-b][1,4]benzodiazepin-6-one (PubChem CID 166635223) has the molecular formula C20H20FN5O4 and a molecular weight of 413.41 g/mol. Its IUPAC name is 5-(3-fluoro-4-methoxyphenyl)-1,4-dimethyl-8-nitro-3,4a-dihydro-2H-pyrazino[2,3-b][1,4]benzodiazepin-6-one.
| Compound Name | 5-(3-fluoro-4-methoxyphenyl)-1,4-dimethyl-8-nitro-3,4a-dihydro-2H-pyrazino[2,3-b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 166635223 |
| Molecular Formula | C20H20FN5O4 |
| Molecular Weight | 413.41 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 5-(3-fluoro-4-methoxyphenyl)-1,4-dimethyl-8-nitro-3,4a-dihydro-2H-pyrazino[2,3-b][1,4]benzodiazepin-6-one |
| SMILES | COc1ccc(N2C(=O)c3cc([N+](=O)[O-])ccc3N=C3C2N(C)CCN3C)cc1F |
| InChI | InChI=1S/C20H20FN5O4/c1-23-8-9-24(2)19-18(23)22-16-6-4-13(26(28)29)10-14(16)20(27)25(19)12-5-7-17(30-3)15(21)11-12/h4-7,10-11,19H,8-9H2,1-3H3 |
| InChIKey | ITIBMENSRFHFIY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 91.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|