About 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfonyl]-6-pyrrol-1-yl-1H-benzimidazole
2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfonyl]-6-pyrrol-1-yl-1H-benzimidazole (PubChem CID 166635226) has the molecular formula C20H20N4O3S
and a molecular weight of 396.47 g/mol. Its IUPAC name is 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfonyl]-6-pyrrol-1-yl-1H-benzimidazole.
Molecular Properties
| Compound Name | 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfonyl]-6-pyrrol-1-yl-1H-benzimidazole |
| PubChem CID | 166635226 |
| Molecular Formula | C20H20N4O3S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfonyl]-6-pyrrol-1-yl-1H-benzimidazole |
| SMILES | COc1c(C)cnc(CS(=O)(=O)c2nc3ccc(-n4cccc4)cc3[nH]2)c1C |
| InChI | InChI=1S/C20H20N4O3S/c1-13-11-21-18(14(2)19(13)27-3)12-28(25,26)20-22-16-7-6-15(10-17(16)23-20)24-8-4-5-9-24/h4-11H,12H2,1-3H3,(H,22,23) |
| InChIKey | IYUIEMWGDCGVKC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfonyl]-6-pyrrol-1-yl-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfonyl]-6-pyrrol-1-yl-1H-benzimidazole?
The IUPAC name of 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfonyl]-6-pyrrol-1-yl-1H-benzimidazole (CID 166635226) is 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfonyl]-6-pyrrol-1-yl-1H-benzimidazole.
What is the SMILES notation for 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfonyl]-6-pyrrol-1-yl-1H-benzimidazole?
The canonical SMILES for 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfonyl]-6-pyrrol-1-yl-1H-benzimidazole is COc1c(C)cnc(CS(=O)(=O)c2nc3ccc(-n4cccc4)cc3[nH]2)c1C.
What is the InChIKey of 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfonyl]-6-pyrrol-1-yl-1H-benzimidazole?
The InChIKey is IYUIEMWGDCGVKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N4O3S/c1-13-11-21-18(14(2)19(13)27-3)12-28(25,26)20-22-16-7-6-15(10-17(16)23-20)24-8-4-5-9-24/h4-11H,12H2,1-3H3,(H,22,23).
What are the key properties of 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfonyl]-6-pyrrol-1-yl-1H-benzimidazole?
2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfonyl]-6-pyrrol-1-yl-1H-benzimidazole has a molecular weight of 396.47 g/mol, XLogP of 3.35, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfonyl]-6-pyrrol-1-yl-1H-benzimidazole is sourced from PubChem (CID 166635226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).