C21H22N6O2 — CID 166635306
(1R,2S,3R,5S)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[2-(1,8-naphthyridin-2-yl)ethyl]cyclopentane-1,2-diol (PubChem CID 166635306) has the molecular formula C21H22N6O2 and a molecular weight of 390.45 g/mol. Its IUPAC name is (1R,2S,3R,5S)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[2-(1,8-naphthyridin-2-yl)ethyl]cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5S)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[2-(1,8-naphthyridin-2-yl)ethyl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 166635306 |
| Molecular Formula | C21H22N6O2 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | (1R,2S,3R,5S)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[2-(1,8-naphthyridin-2-yl)ethyl]cyclopentane-1,2-diol |
| SMILES | Nc1ncnc2c1ccn2[C@@H]1C[C@H](CCc2ccc3cccnc3n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C21H22N6O2/c22-19-15-7-9-27(21(15)25-11-24-19)16-10-13(17(28)18(16)29)4-6-14-5-3-12-2-1-8-23-20(12)26-14/h1-3,5,7-9,11,13,16-18,28-29H,4,6,10H2,(H2,22,24,25)/t13-,16+,17+,18-/m0/s1 |
| InChIKey | HUVRZJIDZCMPAW-LIRZEXBASA-N |
| XLogP | 1.87 |
| TPSA | 122.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |