C23H44O3Si — CID 16663542
(2E,5S,7S,8R,10R,11R)-10-[tert-butyl(dimethyl)silyl]oxy-11-ethyl-8-hydroxy-5,7-dimethyltrideca-2,12-dien-6-one (PubChem CID 16663542) has the molecular formula C23H44O3Si and a molecular weight of 396.69 g/mol. Its IUPAC name is (2E,5S,7S,8R,10R,11R)-10-[tert-butyl(dimethyl)silyl]oxy-11-ethyl-8-hydroxy-5,7-dimethyltrideca-2,12-dien-6-one.
| Compound Name | (2E,5S,7S,8R,10R,11R)-10-[tert-butyl(dimethyl)silyl]oxy-11-ethyl-8-hydroxy-5,7-dimethyltrideca-2,12-dien-6-one |
|---|---|
| PubChem CID | 16663542 |
| Molecular Formula | C23H44O3Si |
| Molecular Weight | 396.69 g/mol |
| Exact Mass | 396.31 |
| IUPAC Name | (2E,5S,7S,8R,10R,11R)-10-[tert-butyl(dimethyl)silyl]oxy-11-ethyl-8-hydroxy-5,7-dimethyltrideca-2,12-dien-6-one |
| SMILES | C=C[C@@H](CC)[C@@H](C[C@@H](O)[C@H](C)C(=O)[C@@H](C)C/C=C/C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H44O3Si/c1-11-14-15-17(4)22(25)18(5)20(24)16-21(19(12-2)13-3)26-27(9,10)23(6,7)8/h11-12,14,17-21,24H,2,13,15-16H2,1,3-10H3/b14-11+/t17-,18-,19-,20+,21+/m0/s1 |
| InChIKey | QJJGYNOVIHLMEP-IVTIZKALSA-N |
| XLogP | 6.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.69 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|