C42H46N4O4 — CID 166635451
N-[6-[[(E)-3-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]prop-2-enoyl]amino]hexyl]-3-(6-methoxy-1H-benzimidazol-2-yl)propanamide (PubChem CID 166635451) has the molecular formula C42H46N4O4 and a molecular weight of 670.85 g/mol. Its IUPAC name is N-[6-[[(E)-3-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]prop-2-enoyl]amino]hexyl]-3-(6-methoxy-1H-benzimidazol-2-yl)propanamide.
| Compound Name | N-[6-[[(E)-3-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]prop-2-enoyl]amino]hexyl]-3-(6-methoxy-1H-benzimidazol-2-yl)propanamide |
|---|---|
| PubChem CID | 166635451 |
| Molecular Formula | C42H46N4O4 |
| Molecular Weight | 670.85 g/mol |
| Exact Mass | 670.35 |
| IUPAC Name | N-[6-[[(E)-3-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]prop-2-enoyl]amino]hexyl]-3-(6-methoxy-1H-benzimidazol-2-yl)propanamide |
| SMILES | CCC(=C(c1ccc(O)cc1)c1ccc(/C=C/C(=O)NCCCCCCNC(=O)CCc2nc3ccc(OC)cc3[nH]2)cc1)c1ccccc1 |
| InChI | InChI=1S/C42H46N4O4/c1-3-36(31-11-7-6-8-12-31)42(33-18-20-34(47)21-19-33)32-16-13-30(14-17-32)15-25-40(48)43-27-9-4-5-10-28-44-41(49)26-24-39-45-37-23-22-35(50-2)29-38(37)46-39/h6-8,11-23,25,29,47H,3-5,9-10,24,26-28H2,1-2H3,(H,43,48)(H,44,49)(H,45,46)/b25-15+,42-36? |
| InChIKey | HQJAAMFRZYIEQD-LKSPLNBLSA-N |
| XLogP | 8.09 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.85 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|