C30H42O4 — CID 166635534
hexyl (2Z,4Z,6S)-6-[(1S,3R,6R,7S,9E,11R)-10-formyl-3,14-dimethyl-12-oxo-6-tricyclo[9.3.0.03,7]tetradeca-9,13-dienyl]hepta-2,4-dienoate (PubChem CID 166635534) has the molecular formula C30H42O4 and a molecular weight of 466.66 g/mol. Its IUPAC name is hexyl (2Z,4Z,6S)-6-[(1S,3R,6R,7S,9E,11R)-10-formyl-3,14-dimethyl-12-oxo-6-tricyclo[9.3.0.03,7]tetradeca-9,13-dienyl]hepta-2,4-dienoate.
| Compound Name | hexyl (2Z,4Z,6S)-6-[(1S,3R,6R,7S,9E,11R)-10-formyl-3,14-dimethyl-12-oxo-6-tricyclo[9.3.0.03,7]tetradeca-9,13-dienyl]hepta-2,4-dienoate |
|---|---|
| PubChem CID | 166635534 |
| Molecular Formula | C30H42O4 |
| Molecular Weight | 466.66 g/mol |
| Exact Mass | 466.31 |
| IUPAC Name | hexyl (2Z,4Z,6S)-6-[(1S,3R,6R,7S,9E,11R)-10-formyl-3,14-dimethyl-12-oxo-6-tricyclo[9.3.0.03,7]tetradeca-9,13-dienyl]hepta-2,4-dienoate |
| SMILES | CCCCCCOC(=O)/C=C\C=C/[C@H](C)[C@H]1CC[C@]2(C)C[C@@H]3C(C)=CC(=O)[C@H]3/C(C=O)=C\C[C@@H]12 |
| InChI | InChI=1S/C30H42O4/c1-5-6-7-10-17-34-28(33)12-9-8-11-21(2)24-15-16-30(4)19-25-22(3)18-27(32)29(25)23(20-31)13-14-26(24)30/h8-9,11-13,18,20-21,24-26,29H,5-7,10,14-17,19H2,1-4H3/b11-8-,12-9-,23-13-/t21-,24+,25+,26-,29-,30+/m0/s1 |
| InChIKey | JVFDYHWRGAFIFQ-UKJATVOJSA-N |
| XLogP | 6.57 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.66 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|