About [(E)-[(5-chloro-1,3-benzoxazol-2-yl)-cyanomethylidene]amino] N,N-dimethylcarbamate
[(E)-[(5-chloro-1,3-benzoxazol-2-yl)-cyanomethylidene]amino] N,N-dimethylcarbamate (PubChem CID 166635617) has the molecular formula C12H9ClN4O3
and a molecular weight of 292.68 g/mol. Its IUPAC name is [(E)-[(5-chloro-1,3-benzoxazol-2-yl)-cyanomethylidene]amino] N,N-dimethylcarbamate.
Molecular Properties
| Compound Name | [(E)-[(5-chloro-1,3-benzoxazol-2-yl)-cyanomethylidene]amino] N,N-dimethylcarbamate |
| PubChem CID | 166635617 |
| Molecular Formula | C12H9ClN4O3 |
| Molecular Weight | 292.68 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | [(E)-[(5-chloro-1,3-benzoxazol-2-yl)-cyanomethylidene]amino] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)O/N=C(\C#N)c1nc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C12H9ClN4O3/c1-17(2)12(18)20-16-9(6-14)11-15-8-5-7(13)3-4-10(8)19-11/h3-5H,1-2H3/b16-9+ |
| InChIKey | AULKQHPPIIIMDE-CXUHLZMHSA-N |
| XLogP | 2.41 |
| TPSA | 91.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.68 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-[(5-chloro-1,3-benzoxazol-2-yl)-cyanomethylidene]amino] N,N-dimethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-[(5-chloro-1,3-benzoxazol-2-yl)-cyanomethylidene]amino] N,N-dimethylcarbamate?
The IUPAC name of [(E)-[(5-chloro-1,3-benzoxazol-2-yl)-cyanomethylidene]amino] N,N-dimethylcarbamate (CID 166635617) is [(E)-[(5-chloro-1,3-benzoxazol-2-yl)-cyanomethylidene]amino] N,N-dimethylcarbamate.
What is the SMILES notation for [(E)-[(5-chloro-1,3-benzoxazol-2-yl)-cyanomethylidene]amino] N,N-dimethylcarbamate?
The canonical SMILES for [(E)-[(5-chloro-1,3-benzoxazol-2-yl)-cyanomethylidene]amino] N,N-dimethylcarbamate is CN(C)C(=O)O/N=C(\C#N)c1nc2cc(Cl)ccc2o1.
What is the InChIKey of [(E)-[(5-chloro-1,3-benzoxazol-2-yl)-cyanomethylidene]amino] N,N-dimethylcarbamate?
The InChIKey is AULKQHPPIIIMDE-CXUHLZMHSA-N. The full InChI is InChI=1S/C12H9ClN4O3/c1-17(2)12(18)20-16-9(6-14)11-15-8-5-7(13)3-4-10(8)19-11/h3-5H,1-2H3/b16-9+.
What are the key properties of [(E)-[(5-chloro-1,3-benzoxazol-2-yl)-cyanomethylidene]amino] N,N-dimethylcarbamate?
[(E)-[(5-chloro-1,3-benzoxazol-2-yl)-cyanomethylidene]amino] N,N-dimethylcarbamate has a molecular weight of 292.68 g/mol, XLogP of 2.41, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-[(5-chloro-1,3-benzoxazol-2-yl)-cyanomethylidene]amino] N,N-dimethylcarbamate is sourced from PubChem (CID 166635617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).