C25H30N5O8P — CID 166635657
propyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 166635657) has the molecular formula C25H30N5O8P and a molecular weight of 559.52 g/mol. Its IUPAC name is propyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 166635657 |
| Molecular Formula | C25H30N5O8P |
| Molecular Weight | 559.52 g/mol |
| Exact Mass | 559.18 |
| IUPAC Name | propyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C#C[C@@]1(O)[C@H](O)[C@@H](COP(=O)(N[C@@H](C)C(=O)OCCC)Oc2ccccc2)O[C@H]1n1ccc2c(N)ncnc21 |
| InChI | InChI=1S/C25H30N5O8P/c1-4-13-35-23(32)16(3)29-39(34,38-17-9-7-6-8-10-17)36-14-19-20(31)25(33,5-2)24(37-19)30-12-11-18-21(26)27-15-28-22(18)30/h2,6-12,15-16,19-20,24,31,33H,4,13-14H2,1,3H3,(H,29,34)(H2,26,27,28)/t16-,19+,20+,24+,25+,39?/m0/s1 |
| InChIKey | HDIWNXBJVITSHL-SUGWFIPISA-N |
| XLogP | 1.77 |
| TPSA | 180.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.52 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|