C13H13FN4O4 — CID 166635743
7-[(5-fluoro-2-pyridinyl)oxymethyl]-7-methyl-2-nitro-5,6-dihydroimidazo[2,1-b][1,3]oxazine (PubChem CID 166635743) has the molecular formula C13H13FN4O4 and a molecular weight of 308.27 g/mol. Its IUPAC name is 7-[(5-fluoro-2-pyridinyl)oxymethyl]-7-methyl-2-nitro-5,6-dihydroimidazo[2,1-b][1,3]oxazine.
| Compound Name | 7-[(5-fluoro-2-pyridinyl)oxymethyl]-7-methyl-2-nitro-5,6-dihydroimidazo[2,1-b][1,3]oxazine |
|---|---|
| PubChem CID | 166635743 |
| Molecular Formula | C13H13FN4O4 |
| Molecular Weight | 308.27 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 7-[(5-fluoro-2-pyridinyl)oxymethyl]-7-methyl-2-nitro-5,6-dihydroimidazo[2,1-b][1,3]oxazine |
| SMILES | CC1(COc2ccc(F)cn2)CCn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C13H13FN4O4/c1-13(8-21-11-3-2-9(14)6-15-11)4-5-17-7-10(18(19)20)16-12(17)22-13/h2-3,6-7H,4-5,8H2,1H3 |
| InChIKey | JKFWNSFZHOZSGT-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 92.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.27 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|