C26H37FO2 — CID 166635951
5-[(1S,2E,4aS,8aS)-2-[(4-fluorophenyl)methylidene]-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpentanoic acid (PubChem CID 166635951) has the molecular formula C26H37FO2 and a molecular weight of 400.58 g/mol. Its IUPAC name is 5-[(1S,2E,4aS,8aS)-2-[(4-fluorophenyl)methylidene]-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpentanoic acid.
| Compound Name | 5-[(1S,2E,4aS,8aS)-2-[(4-fluorophenyl)methylidene]-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 166635951 |
| Molecular Formula | C26H37FO2 |
| Molecular Weight | 400.58 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | 5-[(1S,2E,4aS,8aS)-2-[(4-fluorophenyl)methylidene]-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpentanoic acid |
| SMILES | CC(CC[C@H]1/C(=C/c2ccc(F)cc2)CC[C@H]2C(C)(C)CCC[C@]12C)CC(=O)O |
| InChI | InChI=1S/C26H37FO2/c1-18(16-24(28)29)6-12-22-20(17-19-7-10-21(27)11-8-19)9-13-23-25(2,3)14-5-15-26(22,23)4/h7-8,10-11,17-18,22-23H,5-6,9,12-16H2,1-4H3,(H,28,29)/b20-17+/t18?,22-,23-,26+/m0/s1 |
| InChIKey | NKTITYCMVHGZMX-KDWPZALGSA-N |
| XLogP | 7.34 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.58 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |