C18H13F4N3O3 — CID 166635995
N-[[3-(4-fluoro-2-hydroxyphenyl)-1H-pyrazol-5-yl]methyl]-2-(trifluoromethoxy)benzamide (PubChem CID 166635995) has the molecular formula C18H13F4N3O3 and a molecular weight of 395.31 g/mol. Its IUPAC name is N-[[3-(4-fluoro-2-hydroxyphenyl)-1H-pyrazol-5-yl]methyl]-2-(trifluoromethoxy)benzamide.
| Compound Name | N-[[3-(4-fluoro-2-hydroxyphenyl)-1H-pyrazol-5-yl]methyl]-2-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 166635995 |
| Molecular Formula | C18H13F4N3O3 |
| Molecular Weight | 395.31 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | N-[[3-(4-fluoro-2-hydroxyphenyl)-1H-pyrazol-5-yl]methyl]-2-(trifluoromethoxy)benzamide |
| SMILES | O=C(NCc1cc(-c2ccc(F)cc2O)n[nH]1)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C18H13F4N3O3/c19-10-5-6-12(15(26)7-10)14-8-11(24-25-14)9-23-17(27)13-3-1-2-4-16(13)28-18(20,21)22/h1-8,26H,9H2,(H,23,27)(H,24,25) |
| InChIKey | UCRVWZMWOYQJJO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.31 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |