C35H66N4O2+2 — CID 166636053
4-[dimethyl-[3-[[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoyl]amino]propyl]azaniumyl]butyl-(3-formamidopropyl)-dimethylazanium (PubChem CID 166636053) has the molecular formula C35H66N4O2+2 and a molecular weight of 574.94 g/mol. Its IUPAC name is 4-[dimethyl-[3-[[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoyl]amino]propyl]azaniumyl]butyl-(3-formamidopropyl)-dimethylazanium.
| Compound Name | 4-[dimethyl-[3-[[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoyl]amino]propyl]azaniumyl]butyl-(3-formamidopropyl)-dimethylazanium |
|---|---|
| PubChem CID | 166636053 |
| Molecular Formula | C35H66N4O2+2 |
| Molecular Weight | 574.94 g/mol |
| Exact Mass | 574.52 |
| IUPAC Name | 4-[dimethyl-[3-[[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoyl]amino]propyl]azaniumyl]butyl-(3-formamidopropyl)-dimethylazanium |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/C(=O)NCCC[N+](C)(C)CCCC[N+](C)(C)CCCNC=O |
| InChI | InChI=1S/C35H64N4O2/c1-31(2)17-12-18-32(3)19-13-20-33(4)21-14-22-34(5)29-35(41)37-24-16-28-39(8,9)26-11-10-25-38(6,7)27-15-23-36-30-40/h17,19,21,29-30H,10-16,18,20,22-28H2,1-9H3/p+2/b32-19+,33-21+,34-29+ |
| InChIKey | WVEOYMURLIQKAF-AXWVQUKCSA-P |
| XLogP | 6.71 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.94 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|