C22H24FNO2 — CID 166636110
(3R,3aS,4S,5R,6S,7aR)-4-[5-(3-fluorophenyl)-2-pyridinyl]-3,5,6-trimethyl-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one (PubChem CID 166636110) has the molecular formula C22H24FNO2 and a molecular weight of 353.44 g/mol. Its IUPAC name is (3R,3aS,4S,5R,6S,7aR)-4-[5-(3-fluorophenyl)-2-pyridinyl]-3,5,6-trimethyl-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one.
| Compound Name | (3R,3aS,4S,5R,6S,7aR)-4-[5-(3-fluorophenyl)-2-pyridinyl]-3,5,6-trimethyl-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 166636110 |
| Molecular Formula | C22H24FNO2 |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | (3R,3aS,4S,5R,6S,7aR)-4-[5-(3-fluorophenyl)-2-pyridinyl]-3,5,6-trimethyl-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one |
| SMILES | C[C@H]1[C@H](c2ccc(-c3cccc(F)c3)cn2)[C@@H]2[C@@H](C)OC(=O)[C@@H]2C[C@@H]1C |
| InChI | InChI=1S/C22H24FNO2/c1-12-9-18-21(14(3)26-22(18)25)20(13(12)2)19-8-7-16(11-24-19)15-5-4-6-17(23)10-15/h4-8,10-14,18,20-21H,9H2,1-3H3/t12-,13+,14+,18+,20+,21+/m0/s1 |
| InChIKey | AHWXCIPTJRLETK-OADJZVBOSA-N |
| XLogP | 4.82 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |