C25H23BBrF2I2N3 — CID 166636151
8-(1-benzylpyridin-1-ium-3-yl)-2,2-difluoro-5,11-diiodo-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene bromide (PubChem CID 166636151) has the molecular formula C25H23BBrF2I2N3 and a molecular weight of 748.00 g/mol. Its IUPAC name is 8-(1-benzylpyridin-1-ium-3-yl)-2,2-difluoro-5,11-diiodo-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene bromide.
| Compound Name | 8-(1-benzylpyridin-1-ium-3-yl)-2,2-difluoro-5,11-diiodo-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene bromide |
|---|---|
| PubChem CID | 166636151 |
| Molecular Formula | C25H23BBrF2I2N3 |
| Molecular Weight | 748.00 g/mol |
| Exact Mass | 746.92 |
| IUPAC Name | 8-(1-benzylpyridin-1-ium-3-yl)-2,2-difluoro-5,11-diiodo-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene bromide |
| SMILES | CC1=C(I)C(C)=[N+]2C1=C(c1ccc[n+](Cc3ccccc3)c1)c1c(C)c(I)c(C)n1[B-]2(F)F.[Br-] |
| InChI | InChI=1S/C25H23BF2I2N3.BrH/c1-15-22(29)17(3)32-24(15)21(25-16(2)23(30)18(4)33(25)26(32,27)28)20-11-8-12-31(14-20)13-19-9-6-5-7-10-19;/h5-12,14H,13H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | JHZHHGDAKGRARM-UHFFFAOYSA-M |
| XLogP | 3.24 |
| TPSA | 11.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.00 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|