About 4-(1,3-benzothiazol-6-yl)pyridine-2,6-diamine
4-(1,3-benzothiazol-6-yl)pyridine-2,6-diamine (PubChem CID 166636171) has the molecular formula C12H10N4S
and a molecular weight of 242.31 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-6-yl)pyridine-2,6-diamine.
Molecular Properties
| Compound Name | 4-(1,3-benzothiazol-6-yl)pyridine-2,6-diamine |
| PubChem CID | 166636171 |
| Molecular Formula | C12H10N4S |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 4-(1,3-benzothiazol-6-yl)pyridine-2,6-diamine |
| SMILES | Nc1cc(-c2ccc3ncsc3c2)cc(N)n1 |
| InChI | InChI=1S/C12H10N4S/c13-11-4-8(5-12(14)16-11)7-1-2-9-10(3-7)17-6-15-9/h1-6H,(H4,13,14,16) |
| InChIKey | STIKWXYSQBZFJB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(1,3-benzothiazol-6-yl)pyridine-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-benzothiazol-6-yl)pyridine-2,6-diamine?
The IUPAC name of 4-(1,3-benzothiazol-6-yl)pyridine-2,6-diamine (CID 166636171) is 4-(1,3-benzothiazol-6-yl)pyridine-2,6-diamine.
What is the SMILES notation for 4-(1,3-benzothiazol-6-yl)pyridine-2,6-diamine?
The canonical SMILES for 4-(1,3-benzothiazol-6-yl)pyridine-2,6-diamine is Nc1cc(-c2ccc3ncsc3c2)cc(N)n1.
What is the InChIKey of 4-(1,3-benzothiazol-6-yl)pyridine-2,6-diamine?
The InChIKey is STIKWXYSQBZFJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N4S/c13-11-4-8(5-12(14)16-11)7-1-2-9-10(3-7)17-6-15-9/h1-6H,(H4,13,14,16).
What are the key properties of 4-(1,3-benzothiazol-6-yl)pyridine-2,6-diamine?
4-(1,3-benzothiazol-6-yl)pyridine-2,6-diamine has a molecular weight of 242.31 g/mol, XLogP of 2.52, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-benzothiazol-6-yl)pyridine-2,6-diamine is sourced from PubChem (CID 166636171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).