C25H24ClN5O7S — CID 16663619
[(3S,4S,5R,6R)-4,5-diacetyloxy-6-[4-[(E)-(4-chlorophenyl)methylideneamino]-3-pyridin-3-yl-5-sulfanylidene-1,2,4-triazol-1-yl]oxan-3-yl] acetate (PubChem CID 16663619) has the molecular formula C25H24ClN5O7S and a molecular weight of 574.02 g/mol. Its IUPAC name is [(3S,4S,5R,6R)-4,5-diacetyloxy-6-[4-[(E)-(4-chlorophenyl)methylideneamino]-3-pyridin-3-yl-5-sulfanylidene-1,2,4-triazol-1-yl]oxan-3-yl] acetate.
| Compound Name | [(3S,4S,5R,6R)-4,5-diacetyloxy-6-[4-[(E)-(4-chlorophenyl)methylideneamino]-3-pyridin-3-yl-5-sulfanylidene-1,2,4-triazol-1-yl]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 16663619 |
| Molecular Formula | C25H24ClN5O7S |
| Molecular Weight | 574.02 g/mol |
| Exact Mass | 573.11 |
| IUPAC Name | [(3S,4S,5R,6R)-4,5-diacetyloxy-6-[4-[(E)-(4-chlorophenyl)methylideneamino]-3-pyridin-3-yl-5-sulfanylidene-1,2,4-triazol-1-yl]oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](n2nc(-c3cccnc3)n(/N=C/c3ccc(Cl)cc3)c2=S)OC[C@@H]1OC(C)=O |
| InChI | InChI=1S/C25H24ClN5O7S/c1-14(32)36-20-13-35-24(22(38-16(3)34)21(20)37-15(2)33)31-25(39)30(23(29-31)18-5-4-10-27-12-18)28-11-17-6-8-19(26)9-7-17/h4-12,20-22,24H,13H2,1-3H3/b28-11+/t20-,21-,22+,24+/m0/s1 |
| InChIKey | BPBAZYAHBMOLPA-DRZNKBIOSA-N |
| XLogP | 3.34 |
| TPSA | 136.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.02 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|