About (E)-3-[2-(2,4-difluorophenyl)-1,3-thiazol-5-yl]-N-hydroxyprop-2-enamide
(E)-3-[2-(2,4-difluorophenyl)-1,3-thiazol-5-yl]-N-hydroxyprop-2-enamide (PubChem CID 166636252) has the molecular formula C12H8F2N2O2S
and a molecular weight of 282.27 g/mol. Its IUPAC name is (E)-3-[2-(2,4-difluorophenyl)-1,3-thiazol-5-yl]-N-hydroxyprop-2-enamide.
Molecular Properties
| Compound Name | (E)-3-[2-(2,4-difluorophenyl)-1,3-thiazol-5-yl]-N-hydroxyprop-2-enamide |
| PubChem CID | 166636252 |
| Molecular Formula | C12H8F2N2O2S |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | (E)-3-[2-(2,4-difluorophenyl)-1,3-thiazol-5-yl]-N-hydroxyprop-2-enamide |
| SMILES | O=C(/C=C/c1cnc(-c2ccc(F)cc2F)s1)NO |
| InChI | InChI=1S/C12H8F2N2O2S/c13-7-1-3-9(10(14)5-7)12-15-6-8(19-12)2-4-11(17)16-18/h1-6,18H,(H,16,17)/b4-2+ |
| InChIKey | WQKLLCDRXAPVMM-DUXPYHPUSA-N |
| XLogP | 2.61 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-[2-(2,4-difluorophenyl)-1,3-thiazol-5-yl]-N-hydroxyprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-[2-(2,4-difluorophenyl)-1,3-thiazol-5-yl]-N-hydroxyprop-2-enamide?
The IUPAC name of (E)-3-[2-(2,4-difluorophenyl)-1,3-thiazol-5-yl]-N-hydroxyprop-2-enamide (CID 166636252) is (E)-3-[2-(2,4-difluorophenyl)-1,3-thiazol-5-yl]-N-hydroxyprop-2-enamide.
What is the SMILES notation for (E)-3-[2-(2,4-difluorophenyl)-1,3-thiazol-5-yl]-N-hydroxyprop-2-enamide?
The canonical SMILES for (E)-3-[2-(2,4-difluorophenyl)-1,3-thiazol-5-yl]-N-hydroxyprop-2-enamide is O=C(/C=C/c1cnc(-c2ccc(F)cc2F)s1)NO.
What is the InChIKey of (E)-3-[2-(2,4-difluorophenyl)-1,3-thiazol-5-yl]-N-hydroxyprop-2-enamide?
The InChIKey is WQKLLCDRXAPVMM-DUXPYHPUSA-N. The full InChI is InChI=1S/C12H8F2N2O2S/c13-7-1-3-9(10(14)5-7)12-15-6-8(19-12)2-4-11(17)16-18/h1-6,18H,(H,16,17)/b4-2+.
What are the key properties of (E)-3-[2-(2,4-difluorophenyl)-1,3-thiazol-5-yl]-N-hydroxyprop-2-enamide?
(E)-3-[2-(2,4-difluorophenyl)-1,3-thiazol-5-yl]-N-hydroxyprop-2-enamide has a molecular weight of 282.27 g/mol, XLogP of 2.61, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-[2-(2,4-difluorophenyl)-1,3-thiazol-5-yl]-N-hydroxyprop-2-enamide is sourced from PubChem (CID 166636252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).