C22H27ClN6O2S — CID 166636261
(NZ,4S)-N-(1-aminoethylidene)-5-(4-chlorophenyl)-N'-(diethylsulfamoyl)-4-phenyl-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 166636261) has the molecular formula C22H27ClN6O2S and a molecular weight of 475.02 g/mol. Its IUPAC name is (NZ,4S)-N-(1-aminoethylidene)-5-(4-chlorophenyl)-N'-(diethylsulfamoyl)-4-phenyl-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | (NZ,4S)-N-(1-aminoethylidene)-5-(4-chlorophenyl)-N'-(diethylsulfamoyl)-4-phenyl-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 166636261 |
| Molecular Formula | C22H27ClN6O2S |
| Molecular Weight | 475.02 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | (NZ,4S)-N-(1-aminoethylidene)-5-(4-chlorophenyl)-N'-(diethylsulfamoyl)-4-phenyl-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | CCN(CC)S(=O)(=O)/N=C(/N=C(/C)N)N1C[C@H](c2ccccc2)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C22H27ClN6O2S/c1-4-28(5-2)32(30,31)27-22(25-16(3)24)29-15-20(17-9-7-6-8-10-17)21(26-29)18-11-13-19(23)14-12-18/h6-14,20H,4-5,15H2,1-3H3,(H2,24,25,27)/t20-/m1/s1 |
| InChIKey | LGOBCRUUMMNHGQ-HXUWFJFHSA-N |
| XLogP | 3.46 |
| TPSA | 103.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.02 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|