C20H26N2O2 — CID 166636388
5-(2-cyclopentylethynyl)-2-[(4-hydroxycyclohexyl)amino]benzamide (PubChem CID 166636388) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is 5-(2-cyclopentylethynyl)-2-[(4-hydroxycyclohexyl)amino]benzamide.
| Compound Name | 5-(2-cyclopentylethynyl)-2-[(4-hydroxycyclohexyl)amino]benzamide |
|---|---|
| PubChem CID | 166636388 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 5-(2-cyclopentylethynyl)-2-[(4-hydroxycyclohexyl)amino]benzamide |
| SMILES | NC(=O)c1cc(C#CC2CCCC2)ccc1NC1CCC(O)CC1 |
| InChI | InChI=1S/C20H26N2O2/c21-20(24)18-13-15(6-5-14-3-1-2-4-14)7-12-19(18)22-16-8-10-17(23)11-9-16/h7,12-14,16-17,22-23H,1-4,8-11H2,(H2,21,24) |
| InChIKey | CENZZXCEHAQVMN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|