C13H11F3N4O4 — CID 166636450
2-nitro-7-[[4-(trifluoromethyl)-2-pyridinyl]oxymethyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine (PubChem CID 166636450) has the molecular formula C13H11F3N4O4 and a molecular weight of 344.25 g/mol. Its IUPAC name is 2-nitro-7-[[4-(trifluoromethyl)-2-pyridinyl]oxymethyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine.
| Compound Name | 2-nitro-7-[[4-(trifluoromethyl)-2-pyridinyl]oxymethyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine |
|---|---|
| PubChem CID | 166636450 |
| Molecular Formula | C13H11F3N4O4 |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 2-nitro-7-[[4-(trifluoromethyl)-2-pyridinyl]oxymethyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine |
| SMILES | O=[N+]([O-])c1cn2c(n1)OC(COc1cc(C(F)(F)F)ccn1)CC2 |
| InChI | InChI=1S/C13H11F3N4O4/c14-13(15,16)8-1-3-17-11(5-8)23-7-9-2-4-19-6-10(20(21)22)18-12(19)24-9/h1,3,5-6,9H,2,4,7H2 |
| InChIKey | USAIDVPUQGPARX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 92.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|