C27H23FN4O4 — CID 166636456
2-[(17-fluoro-21-methyl-14-oxo-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7,15(20),16,18-heptaen-7-yl)oxymethyl]-N-hydroxybenzamide (PubChem CID 166636456) has the molecular formula C27H23FN4O4 and a molecular weight of 486.50 g/mol. Its IUPAC name is 2-[(17-fluoro-21-methyl-14-oxo-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7,15(20),16,18-heptaen-7-yl)oxymethyl]-N-hydroxybenzamide.
| Compound Name | 2-[(17-fluoro-21-methyl-14-oxo-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7,15(20),16,18-heptaen-7-yl)oxymethyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 166636456 |
| Molecular Formula | C27H23FN4O4 |
| Molecular Weight | 486.50 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | 2-[(17-fluoro-21-methyl-14-oxo-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7,15(20),16,18-heptaen-7-yl)oxymethyl]-N-hydroxybenzamide |
| SMILES | CN1c2ccc(F)cc2C(=O)N2CCc3c([nH]c4ccc(OCc5ccccc5C(=O)NO)cc34)C21 |
| InChI | InChI=1S/C27H23FN4O4/c1-31-23-9-6-16(28)12-21(23)27(34)32-11-10-19-20-13-17(7-8-22(20)29-24(19)26(31)32)36-14-15-4-2-3-5-18(15)25(33)30-35/h2-9,12-13,26,29,35H,10-11,14H2,1H3,(H,30,33) |
| InChIKey | NKYMWFAJXDAVHN-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 97.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|