C30H30F2N6 — CID 166636555
11,12-difluoro-3,6-bis(4-methylpiperazin-1-yl)phenanthro[9,10-b]quinoxaline (PubChem CID 166636555) has the molecular formula C30H30F2N6 and a molecular weight of 512.61 g/mol. Its IUPAC name is 11,12-difluoro-3,6-bis(4-methylpiperazin-1-yl)phenanthro[9,10-b]quinoxaline.
| Compound Name | 11,12-difluoro-3,6-bis(4-methylpiperazin-1-yl)phenanthro[9,10-b]quinoxaline |
|---|---|
| PubChem CID | 166636555 |
| Molecular Formula | C30H30F2N6 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | 11,12-difluoro-3,6-bis(4-methylpiperazin-1-yl)phenanthro[9,10-b]quinoxaline |
| SMILES | CN1CCN(c2ccc3c(c2)c2cc(N4CCN(C)CC4)ccc2c2nc4cc(F)c(F)cc4nc32)CC1 |
| InChI | InChI=1S/C30H30F2N6/c1-35-7-11-37(12-8-35)19-3-5-21-23(15-19)24-16-20(38-13-9-36(2)10-14-38)4-6-22(24)30-29(21)33-27-17-25(31)26(32)18-28(27)34-30/h3-6,15-18H,7-14H2,1-2H3 |
| InChIKey | UBILWPYJZOYIQN-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 38.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_6666_A(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|