C28H27N3O3 — CID 166636587
9-benzyl-2-(3,5-dimethyl-1,2-oxazol-4-yl)-6-(2-hydroxypropan-2-yl)carbazole-4-carboxamide (PubChem CID 166636587) has the molecular formula C28H27N3O3 and a molecular weight of 453.54 g/mol. Its IUPAC name is 9-benzyl-2-(3,5-dimethyl-1,2-oxazol-4-yl)-6-(2-hydroxypropan-2-yl)carbazole-4-carboxamide.
| Compound Name | 9-benzyl-2-(3,5-dimethyl-1,2-oxazol-4-yl)-6-(2-hydroxypropan-2-yl)carbazole-4-carboxamide |
|---|---|
| PubChem CID | 166636587 |
| Molecular Formula | C28H27N3O3 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | 9-benzyl-2-(3,5-dimethyl-1,2-oxazol-4-yl)-6-(2-hydroxypropan-2-yl)carbazole-4-carboxamide |
| SMILES | Cc1noc(C)c1-c1cc(C(N)=O)c2c3cc(C(C)(C)O)ccc3n(Cc3ccccc3)c2c1 |
| InChI | InChI=1S/C28H27N3O3/c1-16-25(17(2)34-30-16)19-12-22(27(29)32)26-21-14-20(28(3,4)33)10-11-23(21)31(24(26)13-19)15-18-8-6-5-7-9-18/h5-14,33H,15H2,1-4H3,(H2,29,32) |
| InChIKey | SVBUSGJLIGBEJU-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|