C20H22N4O3 — CID 166636614
3-[[2-[(5-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)amino]quinazolin-4-yl]amino]propan-1-ol (PubChem CID 166636614) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is 3-[[2-[(5-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)amino]quinazolin-4-yl]amino]propan-1-ol.
| Compound Name | 3-[[2-[(5-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)amino]quinazolin-4-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 166636614 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 3-[[2-[(5-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)amino]quinazolin-4-yl]amino]propan-1-ol |
| SMILES | Cc1c(Nc2nc(NCCCO)c3ccccc3n2)ccc2c1OCCO2 |
| InChI | InChI=1S/C20H22N4O3/c1-13-15(7-8-17-18(13)27-12-11-26-17)22-20-23-16-6-3-2-5-14(16)19(24-20)21-9-4-10-25/h2-3,5-8,25H,4,9-12H2,1H3,(H2,21,22,23,24) |
| InChIKey | FOBKTZGXWRFSGR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 88.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|