About 4-(4-aminophenyl)aniline;1-methyl-2,4-dinitrosobenzene
4-(4-aminophenyl)aniline;1-methyl-2,4-dinitrosobenzene (PubChem CID 166636644) has the molecular formula C19H18N4O2
and a molecular weight of 334.38 g/mol. Its IUPAC name is 4-(4-aminophenyl)aniline;1-methyl-2,4-dinitrosobenzene.
Molecular Properties
| Compound Name | 4-(4-aminophenyl)aniline;1-methyl-2,4-dinitrosobenzene |
| PubChem CID | 166636644 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 4-(4-aminophenyl)aniline;1-methyl-2,4-dinitrosobenzene |
| SMILES | Cc1ccc(N=O)cc1N=O.Nc1ccc(-c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C12H12N2.C7H6N2O2/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;1-5-2-3-6(8-10)4-7(5)9-11/h1-8H,13-14H2;2-4H,1H3 |
| InChIKey | SRLQAANHCYSRGS-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 110.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-aminophenyl)aniline;1-methyl-2,4-dinitrosobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-aminophenyl)aniline;1-methyl-2,4-dinitrosobenzene?
The IUPAC name of 4-(4-aminophenyl)aniline;1-methyl-2,4-dinitrosobenzene (CID 166636644) is 4-(4-aminophenyl)aniline;1-methyl-2,4-dinitrosobenzene.
What is the SMILES notation for 4-(4-aminophenyl)aniline;1-methyl-2,4-dinitrosobenzene?
The canonical SMILES for 4-(4-aminophenyl)aniline;1-methyl-2,4-dinitrosobenzene is Cc1ccc(N=O)cc1N=O.Nc1ccc(-c2ccc(N)cc2)cc1.
What is the InChIKey of 4-(4-aminophenyl)aniline;1-methyl-2,4-dinitrosobenzene?
The InChIKey is SRLQAANHCYSRGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2.C7H6N2O2/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;1-5-2-3-6(8-10)4-7(5)9-11/h1-8H,13-14H2;2-4H,1H3.
What are the key properties of 4-(4-aminophenyl)aniline;1-methyl-2,4-dinitrosobenzene?
4-(4-aminophenyl)aniline;1-methyl-2,4-dinitrosobenzene has a molecular weight of 334.38 g/mol, XLogP of 5.31, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-aminophenyl)aniline;1-methyl-2,4-dinitrosobenzene is sourced from PubChem (CID 166636644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).