About 4-bromo-8-[1-(trifluoromethyl)cyclobutyl]-1,5-naphthyridine
4-bromo-8-[1-(trifluoromethyl)cyclobutyl]-1,5-naphthyridine (PubChem CID 166636824) has the molecular formula C13H10BrF3N2
and a molecular weight of 331.13 g/mol. Its IUPAC name is 4-bromo-8-[1-(trifluoromethyl)cyclobutyl]-1,5-naphthyridine.
Molecular Properties
| Compound Name | 4-bromo-8-[1-(trifluoromethyl)cyclobutyl]-1,5-naphthyridine |
| PubChem CID | 166636824 |
| Molecular Formula | C13H10BrF3N2 |
| Molecular Weight | 331.13 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | 4-bromo-8-[1-(trifluoromethyl)cyclobutyl]-1,5-naphthyridine |
| SMILES | FC(F)(F)C1(c2ccnc3c(Br)ccnc23)CCC1 |
| InChI | InChI=1S/C13H10BrF3N2/c14-9-3-7-18-10-8(2-6-19-11(9)10)12(4-1-5-12)13(15,16)17/h2-3,6-7H,1,4-5H2 |
| InChIKey | WFSJNDPXVJSVJP-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.13 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-8-[1-(trifluoromethyl)cyclobutyl]-1,5-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-8-[1-(trifluoromethyl)cyclobutyl]-1,5-naphthyridine?
The IUPAC name of 4-bromo-8-[1-(trifluoromethyl)cyclobutyl]-1,5-naphthyridine (CID 166636824) is 4-bromo-8-[1-(trifluoromethyl)cyclobutyl]-1,5-naphthyridine.
What is the SMILES notation for 4-bromo-8-[1-(trifluoromethyl)cyclobutyl]-1,5-naphthyridine?
The canonical SMILES for 4-bromo-8-[1-(trifluoromethyl)cyclobutyl]-1,5-naphthyridine is FC(F)(F)C1(c2ccnc3c(Br)ccnc23)CCC1.
What is the InChIKey of 4-bromo-8-[1-(trifluoromethyl)cyclobutyl]-1,5-naphthyridine?
The InChIKey is WFSJNDPXVJSVJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10BrF3N2/c14-9-3-7-18-10-8(2-6-19-11(9)10)12(4-1-5-12)13(15,16)17/h2-3,6-7H,1,4-5H2.
What are the key properties of 4-bromo-8-[1-(trifluoromethyl)cyclobutyl]-1,5-naphthyridine?
4-bromo-8-[1-(trifluoromethyl)cyclobutyl]-1,5-naphthyridine has a molecular weight of 331.13 g/mol, XLogP of 4.38, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-8-[1-(trifluoromethyl)cyclobutyl]-1,5-naphthyridine is sourced from PubChem (CID 166636824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).