C12H23NaO5SSi — CID 166636849
sodium (3R,3aS,6S,6aS)-3-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-sulfinate (PubChem CID 166636849) has the molecular formula C12H23NaO5SSi and a molecular weight of 330.45 g/mol. Its IUPAC name is sodium (3R,3aS,6S,6aS)-3-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-sulfinate.
| Compound Name | sodium (3R,3aS,6S,6aS)-3-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-sulfinate |
|---|---|
| PubChem CID | 166636849 |
| Molecular Formula | C12H23NaO5SSi |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | sodium (3R,3aS,6S,6aS)-3-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-sulfinate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2S(=O)[O-].[Na+] |
| InChI | InChI=1S/C12H24O5SSi.Na/c1-12(2,3)19(4,5)17-8-6-15-11-9(18(13)14)7-16-10(8)11;/h8-11H,6-7H2,1-5H3,(H,13,14);/q;+1/p-1/t8-,9+,10-,11-;/m1./s1 |
| InChIKey | KZDVPTFPKYRBOP-QCUZDTNBSA-M |
| XLogP | -1.57 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|