C16H26N2O5SSi — CID 166636914
[(3R,3aS,6S,6aS)-6-pyrimidin-2-ylsulfonyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 166636914) has the molecular formula C16H26N2O5SSi and a molecular weight of 386.55 g/mol. Its IUPAC name is [(3R,3aS,6S,6aS)-6-pyrimidin-2-ylsulfonyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3R,3aS,6S,6aS)-6-pyrimidin-2-ylsulfonyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 166636914 |
| Molecular Formula | C16H26N2O5SSi |
| Molecular Weight | 386.55 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | [(3R,3aS,6S,6aS)-6-pyrimidin-2-ylsulfonyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2S(=O)(=O)c1ncccn1 |
| InChI | InChI=1S/C16H26N2O5SSi/c1-16(2,3)25(4,5)23-11-9-21-14-12(10-22-13(11)14)24(19,20)15-17-7-6-8-18-15/h6-8,11-14H,9-10H2,1-5H3/t11-,12+,13-,14-/m1/s1 |
| InChIKey | XLQVDFWEUGINOH-XJFOESAGSA-N |
| XLogP | 1.81 |
| TPSA | 87.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.55 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|