C7H10N2O2S — CID 166636916
2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylsulfonyl)pyrimidine (PubChem CID 166636916) has the molecular formula C7H10N2O2S and a molecular weight of 193.28 g/mol. Its IUPAC name is 2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylsulfonyl)pyrimidine.
| Compound Name | 2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylsulfonyl)pyrimidine |
|---|---|
| PubChem CID | 166636916 |
| Molecular Formula | C7H10N2O2S |
| Molecular Weight | 193.28 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylsulfonyl)pyrimidine |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])S(=O)(=O)c1ncccn1 |
| InChI | InChI=1S/C7H10N2O2S/c1-6(2)12(10,11)7-8-4-3-5-9-7/h3-6H,1-2H3/i1D3,2D3,6D |
| InChIKey | HPESZWPTOCDGTR-NWOXSKRJSA-N |
| XLogP | 0.66 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.28 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |