C19H17F5Si — CID 166636934
bis(ethenyl)-[3-(2,3,4,5,6-pentafluorophenyl)propyl]-phenylsilane (PubChem CID 166636934) has the molecular formula C19H17F5Si and a molecular weight of 368.42 g/mol. Its IUPAC name is bis(ethenyl)-[3-(2,3,4,5,6-pentafluorophenyl)propyl]-phenylsilane.
| Compound Name | bis(ethenyl)-[3-(2,3,4,5,6-pentafluorophenyl)propyl]-phenylsilane |
|---|---|
| PubChem CID | 166636934 |
| Molecular Formula | C19H17F5Si |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | bis(ethenyl)-[3-(2,3,4,5,6-pentafluorophenyl)propyl]-phenylsilane |
| SMILES | C=C[Si](C=C)(CCCc1c(F)c(F)c(F)c(F)c1F)c1ccccc1 |
| InChI | InChI=1S/C19H17F5Si/c1-3-25(4-2,13-9-6-5-7-10-13)12-8-11-14-15(20)17(22)19(24)18(23)16(14)21/h3-7,9-10H,1-2,8,11-12H2 |
| InChIKey | YYEWCIWPZNFTRP-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|