C33H46N4O4 — CID 166637155
(2R)-2-[4-(dimethylamino)cyclohexyl]-6-[(4,6-dimethyl-2-oxopiperidin-3-yl)methyl]-2,4-dimethyl-9-(1-methylpyrrol-2-yl)-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-5-one (PubChem CID 166637155) has the molecular formula C33H46N4O4 and a molecular weight of 562.76 g/mol. Its IUPAC name is (2R)-2-[4-(dimethylamino)cyclohexyl]-6-[(4,6-dimethyl-2-oxopiperidin-3-yl)methyl]-2,4-dimethyl-9-(1-methylpyrrol-2-yl)-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-5-one.
| Compound Name | (2R)-2-[4-(dimethylamino)cyclohexyl]-6-[(4,6-dimethyl-2-oxopiperidin-3-yl)methyl]-2,4-dimethyl-9-(1-methylpyrrol-2-yl)-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-5-one |
|---|---|
| PubChem CID | 166637155 |
| Molecular Formula | C33H46N4O4 |
| Molecular Weight | 562.76 g/mol |
| Exact Mass | 562.35 |
| IUPAC Name | (2R)-2-[4-(dimethylamino)cyclohexyl]-6-[(4,6-dimethyl-2-oxopiperidin-3-yl)methyl]-2,4-dimethyl-9-(1-methylpyrrol-2-yl)-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-5-one |
| SMILES | Cc1c2c(c(-c3cccn3C)c3c1C(=O)N(CC1C(=O)NC(C)CC1C)CC3)O[C@](C)(C1CCC(N(C)C)CC1)O2 |
| InChI | InChI=1S/C33H46N4O4/c1-19-17-20(2)34-31(38)25(19)18-37-16-14-24-27(32(37)39)21(3)29-30(28(24)26-9-8-15-36(26)7)41-33(4,40-29)22-10-12-23(13-11-22)35(5)6/h8-9,15,19-20,22-23,25H,10-14,16-18H2,1-7H3,(H,34,38)/t19?,20?,22?,23?,25?,33-/m1/s1 |
| InChIKey | XMZANYJVWKWREP-VAIMJPKVSA-N |
| XLogP | 4.77 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.76 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|