About 2-[(3R)-3-diethoxyphosphoryl-3-phenylpropyl]-5,5-dimethyl-1,3-dioxane
2-[(3R)-3-diethoxyphosphoryl-3-phenylpropyl]-5,5-dimethyl-1,3-dioxane (PubChem CID 166637254) has the molecular formula C19H31O5P
and a molecular weight of 370.43 g/mol. Its IUPAC name is 2-[(3R)-3-diethoxyphosphoryl-3-phenylpropyl]-5,5-dimethyl-1,3-dioxane.
Molecular Properties
| Compound Name | 2-[(3R)-3-diethoxyphosphoryl-3-phenylpropyl]-5,5-dimethyl-1,3-dioxane |
| PubChem CID | 166637254 |
| Molecular Formula | C19H31O5P |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 2-[(3R)-3-diethoxyphosphoryl-3-phenylpropyl]-5,5-dimethyl-1,3-dioxane |
| SMILES | CCOP(=O)(OCC)[C@H](CCC1OCC(C)(C)CO1)c1ccccc1 |
| InChI | InChI=1S/C19H31O5P/c1-5-23-25(20,24-6-2)17(16-10-8-7-9-11-16)12-13-18-21-14-19(3,4)15-22-18/h7-11,17-18H,5-6,12-15H2,1-4H3/t17-/m1/s1 |
| InChIKey | MELQRBCAJDCFAB-QGZVFWFLSA-N |
| XLogP | 5.17 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3R)-3-diethoxyphosphoryl-3-phenylpropyl]-5,5-dimethyl-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3R)-3-diethoxyphosphoryl-3-phenylpropyl]-5,5-dimethyl-1,3-dioxane?
The IUPAC name of 2-[(3R)-3-diethoxyphosphoryl-3-phenylpropyl]-5,5-dimethyl-1,3-dioxane (CID 166637254) is 2-[(3R)-3-diethoxyphosphoryl-3-phenylpropyl]-5,5-dimethyl-1,3-dioxane.
What is the SMILES notation for 2-[(3R)-3-diethoxyphosphoryl-3-phenylpropyl]-5,5-dimethyl-1,3-dioxane?
The canonical SMILES for 2-[(3R)-3-diethoxyphosphoryl-3-phenylpropyl]-5,5-dimethyl-1,3-dioxane is CCOP(=O)(OCC)[C@H](CCC1OCC(C)(C)CO1)c1ccccc1.
What is the InChIKey of 2-[(3R)-3-diethoxyphosphoryl-3-phenylpropyl]-5,5-dimethyl-1,3-dioxane?
The InChIKey is MELQRBCAJDCFAB-QGZVFWFLSA-N. The full InChI is InChI=1S/C19H31O5P/c1-5-23-25(20,24-6-2)17(16-10-8-7-9-11-16)12-13-18-21-14-19(3,4)15-22-18/h7-11,17-18H,5-6,12-15H2,1-4H3/t17-/m1/s1.
What are the key properties of 2-[(3R)-3-diethoxyphosphoryl-3-phenylpropyl]-5,5-dimethyl-1,3-dioxane?
2-[(3R)-3-diethoxyphosphoryl-3-phenylpropyl]-5,5-dimethyl-1,3-dioxane has a molecular weight of 370.43 g/mol, XLogP of 5.17, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3R)-3-diethoxyphosphoryl-3-phenylpropyl]-5,5-dimethyl-1,3-dioxane is sourced from PubChem (CID 166637254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).