About ethyl (Z)-4,4,4-trifluoro-3-[(4-nitrophenyl)methylamino]but-2-enoate
ethyl (Z)-4,4,4-trifluoro-3-[(4-nitrophenyl)methylamino]but-2-enoate (PubChem CID 16663759) has the molecular formula C13H13F3N2O4
and a molecular weight of 318.25 g/mol. Its IUPAC name is ethyl (Z)-4,4,4-trifluoro-3-[(4-nitrophenyl)methylamino]but-2-enoate.
Molecular Properties
| Compound Name | ethyl (Z)-4,4,4-trifluoro-3-[(4-nitrophenyl)methylamino]but-2-enoate |
| PubChem CID | 16663759 |
| Molecular Formula | C13H13F3N2O4 |
| Molecular Weight | 318.25 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | ethyl (Z)-4,4,4-trifluoro-3-[(4-nitrophenyl)methylamino]but-2-enoate |
| SMILES | CCOC(=O)/C=C(\NCc1ccc([N+](=O)[O-])cc1)C(F)(F)F |
| InChI | InChI=1S/C13H13F3N2O4/c1-2-22-12(19)7-11(13(14,15)16)17-8-9-3-5-10(6-4-9)18(20)21/h3-7,17H,2,8H2,1H3/b11-7- |
| InChIKey | YHLNZMQJEPSTTA-XFFZJAGNSA-N |
| XLogP | 2.69 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.25 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl (Z)-4,4,4-trifluoro-3-[(4-nitrophenyl)methylamino]but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (Z)-4,4,4-trifluoro-3-[(4-nitrophenyl)methylamino]but-2-enoate?
The IUPAC name of ethyl (Z)-4,4,4-trifluoro-3-[(4-nitrophenyl)methylamino]but-2-enoate (CID 16663759) is ethyl (Z)-4,4,4-trifluoro-3-[(4-nitrophenyl)methylamino]but-2-enoate.
What is the SMILES notation for ethyl (Z)-4,4,4-trifluoro-3-[(4-nitrophenyl)methylamino]but-2-enoate?
The canonical SMILES for ethyl (Z)-4,4,4-trifluoro-3-[(4-nitrophenyl)methylamino]but-2-enoate is CCOC(=O)/C=C(\NCc1ccc([N+](=O)[O-])cc1)C(F)(F)F.
What is the InChIKey of ethyl (Z)-4,4,4-trifluoro-3-[(4-nitrophenyl)methylamino]but-2-enoate?
The InChIKey is YHLNZMQJEPSTTA-XFFZJAGNSA-N. The full InChI is InChI=1S/C13H13F3N2O4/c1-2-22-12(19)7-11(13(14,15)16)17-8-9-3-5-10(6-4-9)18(20)21/h3-7,17H,2,8H2,1H3/b11-7-.
What are the key properties of ethyl (Z)-4,4,4-trifluoro-3-[(4-nitrophenyl)methylamino]but-2-enoate?
ethyl (Z)-4,4,4-trifluoro-3-[(4-nitrophenyl)methylamino]but-2-enoate has a molecular weight of 318.25 g/mol, XLogP of 2.69, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (Z)-4,4,4-trifluoro-3-[(4-nitrophenyl)methylamino]but-2-enoate is sourced from PubChem (CID 16663759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).