C50H36BrN3S — CID 166637881
2-[4-[1,3-bis(naphthalen-2-ylmethyl)-4,5-diphenylimidazol-1-ium-2-yl]phenyl]-1,3-benzothiazole bromide (PubChem CID 166637881) has the molecular formula C50H36BrN3S and a molecular weight of 790.83 g/mol. Its IUPAC name is 2-[4-[1,3-bis(naphthalen-2-ylmethyl)-4,5-diphenylimidazol-1-ium-2-yl]phenyl]-1,3-benzothiazole bromide.
| Compound Name | 2-[4-[1,3-bis(naphthalen-2-ylmethyl)-4,5-diphenylimidazol-1-ium-2-yl]phenyl]-1,3-benzothiazole bromide |
|---|---|
| PubChem CID | 166637881 |
| Molecular Formula | C50H36BrN3S |
| Molecular Weight | 790.83 g/mol |
| Exact Mass | 789.18 |
| IUPAC Name | 2-[4-[1,3-bis(naphthalen-2-ylmethyl)-4,5-diphenylimidazol-1-ium-2-yl]phenyl]-1,3-benzothiazole bromide |
| SMILES | [Br-].c1ccc(-c2c(-c3ccccc3)[n+](Cc3ccc4ccccc4c3)c(-c3ccc(-c4nc5ccccc5s4)cc3)n2Cc2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C50H36N3S.BrH/c1-3-15-39(16-4-1)47-48(40-17-5-2-6-18-40)53(34-36-24-26-38-14-8-10-20-44(38)32-36)50(52(47)33-35-23-25-37-13-7-9-19-43(37)31-35)42-29-27-41(28-30-42)49-51-45-21-11-12-22-46(45)54-49;/h1-32H,33-34H2;1H/q+1;/p-1 |
| InChIKey | DHOOAYMKYAQOFR-UHFFFAOYSA-M |
| XLogP | 9.46 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.83 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|